C19H35NOSi — CID 25179193
(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-N-methyl-6-phenylhexan-2-amine (PubChem CID 25179193) has the molecular formula C19H35NOSi and a molecular weight of 321.58 g/mol. Its IUPAC name is (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-N-methyl-6-phenylhexan-2-amine.
| Compound Name | (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-N-methyl-6-phenylhexan-2-amine |
|---|---|
| PubChem CID | 25179193 |
| Molecular Formula | C19H35NOSi |
| Molecular Weight | 321.58 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-N-methyl-6-phenylhexan-2-amine |
| SMILES | CN[C@@H](C)C[C@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35NOSi/c1-16(20-5)15-18(21-22(6,7)19(2,3)4)14-13-17-11-9-8-10-12-17/h8-12,16,18,20H,13-15H2,1-7H3/t16-,18-/m0/s1 |
| InChIKey | KUVSSNTVGJCHPB-WMZOPIPTSA-N |
| XLogP | 5.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|