C21H34O3Si — CID 158278224
tert-butyl-dimethyl-[(Z)-1-phenyloct-5-en-3-yl]oxysilane;carbon dioxide (PubChem CID 158278224) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-1-phenyloct-5-en-3-yl]oxysilane;carbon dioxide.
| Compound Name | tert-butyl-dimethyl-[(Z)-1-phenyloct-5-en-3-yl]oxysilane;carbon dioxide |
|---|---|
| PubChem CID | 158278224 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-1-phenyloct-5-en-3-yl]oxysilane;carbon dioxide |
| SMILES | CC/C=C\CC(CCc1ccccc1)O[Si](C)(C)C(C)(C)C.O=C=O |
| InChI | InChI=1S/C20H34OSi.CO2/c1-7-8-10-15-19(21-22(5,6)20(2,3)4)17-16-18-13-11-9-12-14-18;2-1-3/h8-14,19H,7,15-17H2,1-6H3;/b10-8-; |
| InChIKey | GJWOELQUMJEIBM-DQMXGCRQSA-N |
| XLogP | 5.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|