C18H26O — CID 102008649
(5E,9E)-1-phenyldodeca-5,9-dien-3-ol (PubChem CID 102008649) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (5E,9E)-1-phenyldodeca-5,9-dien-3-ol.
| Compound Name | (5E,9E)-1-phenyldodeca-5,9-dien-3-ol |
|---|---|
| PubChem CID | 102008649 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (5E,9E)-1-phenyldodeca-5,9-dien-3-ol |
| SMILES | CC/C=C/CC/C=C/CC(O)CCc1ccccc1 |
| InChI | InChI=1S/C18H26O/c1-2-3-4-5-6-7-11-14-18(19)16-15-17-12-9-8-10-13-17/h3-4,7-13,18-19H,2,5-6,14-16H2,1H3/b4-3+,11-7+ |
| InChIKey | GCEKYCZDLZVDNP-KDYKCUIDSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|