About [(3E,7Z)-deca-3,7-dien-2-yl]benzene
[(3E,7Z)-deca-3,7-dien-2-yl]benzene (PubChem CID 123551652) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is [(3E,7Z)-deca-3,7-dien-2-yl]benzene.
Molecular Properties
| Compound Name | [(3E,7Z)-deca-3,7-dien-2-yl]benzene |
| PubChem CID | 123551652 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | [(3E,7Z)-deca-3,7-dien-2-yl]benzene |
| SMILES | CC/C=C\CC/C=C/C(C)c1ccccc1 |
| InChI | InChI=1S/C16H22/c1-3-4-5-6-7-9-12-15(2)16-13-10-8-11-14-16/h4-5,8-15H,3,6-7H2,1-2H3/b5-4-,12-9+ |
| InChIKey | YWYRKPXRDSLUQF-KVWUJKKISA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3E,7Z)-deca-3,7-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E,7Z)-deca-3,7-dien-2-yl]benzene?
The IUPAC name of [(3E,7Z)-deca-3,7-dien-2-yl]benzene (CID 123551652) is [(3E,7Z)-deca-3,7-dien-2-yl]benzene.
What is the SMILES notation for [(3E,7Z)-deca-3,7-dien-2-yl]benzene?
The canonical SMILES for [(3E,7Z)-deca-3,7-dien-2-yl]benzene is CC/C=C\CC/C=C/C(C)c1ccccc1.
What is the InChIKey of [(3E,7Z)-deca-3,7-dien-2-yl]benzene?
The InChIKey is YWYRKPXRDSLUQF-KVWUJKKISA-N. The full InChI is InChI=1S/C16H22/c1-3-4-5-6-7-9-12-15(2)16-13-10-8-11-14-16/h4-5,8-15H,3,6-7H2,1-2H3/b5-4-,12-9+.
What are the key properties of [(3E,7Z)-deca-3,7-dien-2-yl]benzene?
[(3E,7Z)-deca-3,7-dien-2-yl]benzene has a molecular weight of 214.35 g/mol, XLogP of 5.09, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E,7Z)-deca-3,7-dien-2-yl]benzene is sourced from PubChem (CID 123551652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).