C15H21NO — CID 12032852
(E)-N,N-diethyl-4-phenylpent-2-enamide (PubChem CID 12032852) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (E)-N,N-diethyl-4-phenylpent-2-enamide.
| Compound Name | (E)-N,N-diethyl-4-phenylpent-2-enamide |
|---|---|
| PubChem CID | 12032852 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (E)-N,N-diethyl-4-phenylpent-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/C(C)c1ccccc1 |
| InChI | InChI=1S/C15H21NO/c1-4-16(5-2)15(17)12-11-13(3)14-9-7-6-8-10-14/h6-13H,4-5H2,1-3H3/b12-11+ |
| InChIKey | QKZQIXJDRYHIAP-VAWYXSNFSA-N |
| XLogP | 3.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|