C22H28ClNO2 — CID 175493317
ethyl (Z)-2-(diethylamino)-4,4-diphenylbut-2-enoate;hydrochloride (PubChem CID 175493317) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is ethyl (Z)-2-(diethylamino)-4,4-diphenylbut-2-enoate;hydrochloride.
| Compound Name | ethyl (Z)-2-(diethylamino)-4,4-diphenylbut-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 175493317 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | ethyl (Z)-2-(diethylamino)-4,4-diphenylbut-2-enoate;hydrochloride |
| SMILES | CCOC(=O)/C(=C/C(c1ccccc1)c1ccccc1)N(CC)CC.Cl |
| InChI | InChI=1S/C22H27NO2.ClH/c1-4-23(5-2)21(22(24)25-6-3)17-20(18-13-9-7-10-14-18)19-15-11-8-12-16-19;/h7-17,20H,4-6H2,1-3H3;1H/b21-17-; |
| InChIKey | LEDUCABFRSGLDF-BMEBGVJCSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|