C19H32N2O4S2 — CID 146314690
carbamothioic S-acid;diethylcarbamothioic S-acid;ethyl 3-methyl-2-phenylbutanoate (PubChem CID 146314690) has the molecular formula C19H32N2O4S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is carbamothioic S-acid;diethylcarbamothioic S-acid;ethyl 3-methyl-2-phenylbutanoate.
| Compound Name | carbamothioic S-acid;diethylcarbamothioic S-acid;ethyl 3-methyl-2-phenylbutanoate |
|---|---|
| PubChem CID | 146314690 |
| Molecular Formula | C19H32N2O4S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | carbamothioic S-acid;diethylcarbamothioic S-acid;ethyl 3-methyl-2-phenylbutanoate |
| SMILES | CCN(CC)C(=O)S.CCOC(=O)C(c1ccccc1)C(C)C.NC(=O)S |
| InChI | InChI=1S/C13H18O2.C5H11NOS.CH3NOS/c1-4-15-13(14)12(10(2)3)11-8-6-5-7-9-11;1-3-6(4-2)5(7)8;2-1(3)4/h5-10,12H,4H2,1-3H3;3-4H2,1-2H3,(H,7,8);(H3,2,3,4) |
| InChIKey | UJLNHEZUIRNTRP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|