C15H27N3O2S2 — CID 88595563
carbamothioic S-acid;diethylcarbamothioic S-acid;2-phenylpropan-2-amine (PubChem CID 88595563) has the molecular formula C15H27N3O2S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is carbamothioic S-acid;diethylcarbamothioic S-acid;2-phenylpropan-2-amine.
| Compound Name | carbamothioic S-acid;diethylcarbamothioic S-acid;2-phenylpropan-2-amine |
|---|---|
| PubChem CID | 88595563 |
| Molecular Formula | C15H27N3O2S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | carbamothioic S-acid;diethylcarbamothioic S-acid;2-phenylpropan-2-amine |
| SMILES | CC(C)(N)c1ccccc1.CCN(CC)C(=O)S.NC(=O)S |
| InChI | InChI=1S/C9H13N.C5H11NOS.CH3NOS/c1-9(2,10)8-6-4-3-5-7-8;1-3-6(4-2)5(7)8;2-1(3)4/h3-7H,10H2,1-2H3;3-4H2,1-2H3,(H,7,8);(H3,2,3,4) |
| InChIKey | VUBAVBRVPMTRJR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|