C14H23FN2O2S2 — CID 174345496
carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate;fluorobenzene (PubChem CID 174345496) has the molecular formula C14H23FN2O2S2 and a molecular weight of 334.48 g/mol. Its IUPAC name is carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate;fluorobenzene.
| Compound Name | carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate;fluorobenzene |
|---|---|
| PubChem CID | 174345496 |
| Molecular Formula | C14H23FN2O2S2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate;fluorobenzene |
| SMILES | CCOC(=S)N(CC)CC.Fc1ccccc1.NC(=O)S |
| InChI | InChI=1S/C7H15NOS.C6H5F.CH3NOS/c1-4-8(5-2)7(10)9-6-3;7-6-4-2-1-3-5-6;2-1(3)4/h4-6H2,1-3H3;1-5H;(H3,2,3,4) |
| InChIKey | UUHZJECAALVUDU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|