C9H21N3O4S2 — CID 174420306
carbamic acid;carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate (PubChem CID 174420306) has the molecular formula C9H21N3O4S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is carbamic acid;carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate.
| Compound Name | carbamic acid;carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 174420306 |
| Molecular Formula | C9H21N3O4S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | carbamic acid;carbamothioic S-acid;O-ethyl N,N-diethylcarbamothioate |
| SMILES | CCOC(=S)N(CC)CC.NC(=O)O.NC(=O)S |
| InChI | InChI=1S/C7H15NOS.CH3NO2.CH3NOS/c1-4-8(5-2)7(10)9-6-3;2*2-1(3)4/h4-6H2,1-3H3;2H2,(H,3,4);(H3,2,3,4) |
| InChIKey | GRXMJGPRJFHBKM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|