C6H14AlN2O2S2 — CID 174602065
CID 174602065 (PubChem CID 174602065) has the molecular formula C6H14AlN2O2S2 and a molecular weight of 237.31 g/mol.
| Compound Name | CID 174602065 |
|---|---|
| PubChem CID | 174602065 |
| Molecular Formula | C6H14AlN2O2S2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)S.NC(=O)S.[Al] |
| InChI | InChI=1S/C5H11NOS.CH3NOS.Al/c1-3-6(4-2)5(7)8;2-1(3)4;/h3-4H2,1-2H3,(H,7,8);(H3,2,3,4); |
| InChIKey | RIRKNTPSDZOULL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|