C6H16N2O2 — CID 88508313
1,1-diethylurea;methanol (PubChem CID 88508313) has the molecular formula C6H16N2O2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,1-diethylurea;methanol.
| Compound Name | 1,1-diethylurea;methanol |
|---|---|
| PubChem CID | 88508313 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | 1,1-diethylurea;methanol |
| SMILES | CCN(CC)C(N)=O.CO |
| InChI | InChI=1S/C5H12N2O.CH4O/c1-3-7(4-2)5(6)8;1-2/h3-4H2,1-2H3,(H2,6,8);2H,1H3 |
| InChIKey | XXTWQFFSPIEUEP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |