About 1-ethyl-1-methylurea
1-ethyl-1-methylurea (PubChem CID 3032104) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is 1-ethyl-1-methylurea.
Molecular Properties
| Compound Name | 1-ethyl-1-methylurea |
| PubChem CID | 3032104 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | 1-ethyl-1-methylurea |
| SMILES | CCN(C)C(N)=O |
| InChI | InChI=1S/C4H10N2O/c1-3-6(2)4(5)7/h3H2,1-2H3,(H2,5,7) |
| InChIKey | UZPCSQYZDLKMCC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methylurea?
The IUPAC name of 1-ethyl-1-methylurea (CID 3032104) is 1-ethyl-1-methylurea.
What is the SMILES notation for 1-ethyl-1-methylurea?
The canonical SMILES for 1-ethyl-1-methylurea is CCN(C)C(N)=O.
What is the InChIKey of 1-ethyl-1-methylurea?
The InChIKey is UZPCSQYZDLKMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-3-6(2)4(5)7/h3H2,1-2H3,(H2,5,7).
What are the key properties of 1-ethyl-1-methylurea?
1-ethyl-1-methylurea has a molecular weight of 102.14 g/mol, XLogP of 0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylurea is sourced from PubChem (CID 3032104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).