About S-iodo N-ethyl-N-methylcarbamothioate
S-iodo N-ethyl-N-methylcarbamothioate (PubChem CID 166684572) has the molecular formula C4H8INOS
and a molecular weight of 245.08 g/mol. Its IUPAC name is S-iodo N-ethyl-N-methylcarbamothioate.
Molecular Properties
| Compound Name | S-iodo N-ethyl-N-methylcarbamothioate |
| PubChem CID | 166684572 |
| Molecular Formula | C4H8INOS |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | S-iodo N-ethyl-N-methylcarbamothioate |
| SMILES | CCN(C)C(=O)SI |
| InChI | InChI=1S/C4H8INOS/c1-3-6(2)4(7)8-5/h3H2,1-2H3 |
| InChIKey | XJBJKEYXRCZJFI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-iodo N-ethyl-N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-iodo N-ethyl-N-methylcarbamothioate?
The IUPAC name of S-iodo N-ethyl-N-methylcarbamothioate (CID 166684572) is S-iodo N-ethyl-N-methylcarbamothioate.
What is the SMILES notation for S-iodo N-ethyl-N-methylcarbamothioate?
The canonical SMILES for S-iodo N-ethyl-N-methylcarbamothioate is CCN(C)C(=O)SI.
What is the InChIKey of S-iodo N-ethyl-N-methylcarbamothioate?
The InChIKey is XJBJKEYXRCZJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8INOS/c1-3-6(2)4(7)8-5/h3H2,1-2H3.
What are the key properties of S-iodo N-ethyl-N-methylcarbamothioate?
S-iodo N-ethyl-N-methylcarbamothioate has a molecular weight of 245.08 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-iodo N-ethyl-N-methylcarbamothioate is sourced from PubChem (CID 166684572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).