About bis(N-ethyl-N-methylpropanamide);pentan-3-one
bis(N-ethyl-N-methylpropanamide);pentan-3-one (PubChem CID 158092722) has the molecular formula C17H36N2O3
and a molecular weight of 316.49 g/mol. Its IUPAC name is bis(N-ethyl-N-methylpropanamide);pentan-3-one.
Molecular Properties
| Compound Name | bis(N-ethyl-N-methylpropanamide);pentan-3-one |
| PubChem CID | 158092722 |
| Molecular Formula | C17H36N2O3 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.27 |
| IUPAC Name | bis(N-ethyl-N-methylpropanamide);pentan-3-one |
| SMILES | CCC(=O)CC.CCC(=O)N(C)CC.CCC(=O)N(C)CC |
| InChI | InChI=1S/2C6H13NO.C5H10O/c2*1-4-6(8)7(3)5-2;1-3-5(6)4-2/h2*4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | FOHMJTATPJJFTH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(N-ethyl-N-methylpropanamide);pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-ethyl-N-methylpropanamide);pentan-3-one?
The IUPAC name of bis(N-ethyl-N-methylpropanamide);pentan-3-one (CID 158092722) is bis(N-ethyl-N-methylpropanamide);pentan-3-one.
What is the SMILES notation for bis(N-ethyl-N-methylpropanamide);pentan-3-one?
The canonical SMILES for bis(N-ethyl-N-methylpropanamide);pentan-3-one is CCC(=O)CC.CCC(=O)N(C)CC.CCC(=O)N(C)CC.
What is the InChIKey of bis(N-ethyl-N-methylpropanamide);pentan-3-one?
The InChIKey is FOHMJTATPJJFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13NO.C5H10O/c2*1-4-6(8)7(3)5-2;1-3-5(6)4-2/h2*4-5H2,1-3H3;3-4H2,1-2H3.
What are the key properties of bis(N-ethyl-N-methylpropanamide);pentan-3-one?
bis(N-ethyl-N-methylpropanamide);pentan-3-one has a molecular weight of 316.49 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-ethyl-N-methylpropanamide);pentan-3-one is sourced from PubChem (CID 158092722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).