C6H14N2O — CID 18683928
N-ethyl-N-methyl-2-(methylamino)acetamide (PubChem CID 18683928) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-(methylamino)acetamide.
| Compound Name | N-ethyl-N-methyl-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 18683928 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | N-ethyl-N-methyl-2-(methylamino)acetamide |
| SMILES | CCN(C)C(=O)CNC |
| InChI | InChI=1S/C6H14N2O/c1-4-8(3)6(9)5-7-2/h7H,4-5H2,1-3H3 |
| InChIKey | XKCNMLXHPBMLES-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |