C4H10N2O2 — CID 131096928
N-hydroxy-N-methyl-2-(methylamino)acetamide (PubChem CID 131096928) has the molecular formula C4H10N2O2 and a molecular weight of 118.14 g/mol. Its IUPAC name is N-hydroxy-N-methyl-2-(methylamino)acetamide.
| Compound Name | N-hydroxy-N-methyl-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 131096928 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | N-hydroxy-N-methyl-2-(methylamino)acetamide |
| SMILES | CNCC(=O)N(C)O |
| InChI | InChI=1S/C4H10N2O2/c1-5-3-4(7)6(2)8/h5,8H,3H2,1-2H3 |
| InChIKey | VECSTLSBZKGLTQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|