C5H14N2O5S — CID 87663506
N,N-dimethyl-2-(methylamino)acetamide;sulfuric acid (PubChem CID 87663506) has the molecular formula C5H14N2O5S and a molecular weight of 214.24 g/mol. Its IUPAC name is N,N-dimethyl-2-(methylamino)acetamide;sulfuric acid.
| Compound Name | N,N-dimethyl-2-(methylamino)acetamide;sulfuric acid |
|---|---|
| PubChem CID | 87663506 |
| Molecular Formula | C5H14N2O5S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N,N-dimethyl-2-(methylamino)acetamide;sulfuric acid |
| SMILES | CNCC(=O)N(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C5H12N2O.H2O4S/c1-6-4-5(8)7(2)3;1-5(2,3)4/h6H,4H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | CTWSWFIVTYVZCM-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|