C16H24N2O — CID 91368544
2,3-dimethyl-1,4-dihydronaphthalene;1-ethyl-1-methylurea (PubChem CID 91368544) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dihydronaphthalene;1-ethyl-1-methylurea.
| Compound Name | 2,3-dimethyl-1,4-dihydronaphthalene;1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 91368544 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2,3-dimethyl-1,4-dihydronaphthalene;1-ethyl-1-methylurea |
| SMILES | CC1=C(C)Cc2ccccc2C1.CCN(C)C(N)=O |
| InChI | InChI=1S/C12H14.C4H10N2O/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-3-6(2)4(5)7/h3-6H,7-8H2,1-2H3;3H2,1-2H3,(H2,5,7) |
| InChIKey | ZPKXDMOJKKNVOF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|