C19H27NO — CID 91126999
2,3-dimethyl-1,4-dihydronaphthalene;5-methyliminohexan-3-one (PubChem CID 91126999) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dihydronaphthalene;5-methyliminohexan-3-one.
| Compound Name | 2,3-dimethyl-1,4-dihydronaphthalene;5-methyliminohexan-3-one |
|---|---|
| PubChem CID | 91126999 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2,3-dimethyl-1,4-dihydronaphthalene;5-methyliminohexan-3-one |
| SMILES | CC1=C(C)Cc2ccccc2C1.CCC(=O)C/C(C)=N/C |
| InChI | InChI=1S/C12H14.C7H13NO/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-4-7(9)5-6(2)8-3/h3-6H,7-8H2,1-2H3;4-5H2,1-3H3/b;8-6+ |
| InChIKey | KYZNSKYQIFQOMM-ZQGZPJDTSA-N |
| XLogP | 4.57 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|