C5H13N2NaO — CID 173115035
sodium;1,1-diethylurea;hydride (PubChem CID 173115035) has the molecular formula C5H13N2NaO and a molecular weight of 140.16 g/mol. Its IUPAC name is sodium;1,1-diethylurea;hydride.
| Compound Name | sodium;1,1-diethylurea;hydride |
|---|---|
| PubChem CID | 173115035 |
| Molecular Formula | C5H13N2NaO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | sodium;1,1-diethylurea;hydride |
| SMILES | CCN(CC)C(N)=O.[H-].[Na+] |
| InChI | InChI=1S/C5H12N2O.Na.H/c1-3-7(4-2)5(6)8;;/h3-4H2,1-2H3,(H2,6,8);;/q;+1;-1 |
| InChIKey | UVQGUFXMKPASDF-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |