C9H21FN2O — CID 175553250
1,1,3,3-tetraethylurea;hydrofluoride (PubChem CID 175553250) has the molecular formula C9H21FN2O and a molecular weight of 192.28 g/mol. Its IUPAC name is 1,1,3,3-tetraethylurea;hydrofluoride.
| Compound Name | 1,1,3,3-tetraethylurea;hydrofluoride |
|---|---|
| PubChem CID | 175553250 |
| Molecular Formula | C9H21FN2O |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1,1,3,3-tetraethylurea;hydrofluoride |
| SMILES | CCN(CC)C(=O)N(CC)CC.F |
| InChI | InChI=1S/C9H20N2O.FH/c1-5-10(6-2)9(12)11(7-3)8-4;/h5-8H2,1-4H3;1H |
| InChIKey | FFUYQANZEAWGHI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |