C13H24N2O — CID 115629557
1,1-bis(cyclopropylmethyl)-3,3-diethylurea (PubChem CID 115629557) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1,1-bis(cyclopropylmethyl)-3,3-diethylurea.
| Compound Name | 1,1-bis(cyclopropylmethyl)-3,3-diethylurea |
|---|---|
| PubChem CID | 115629557 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1,1-bis(cyclopropylmethyl)-3,3-diethylurea |
| SMILES | CCN(CC)C(=O)N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C13H24N2O/c1-3-14(4-2)13(16)15(9-11-5-6-11)10-12-7-8-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | JKCQJXCQJDQIIS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |