C20H34N2O2 — CID 23534016
N-ethyl-N-[[4-[[ethyl(2-methylprop-2-enoyl)amino]methyl]cyclohexyl]methyl]-2-methylprop-2-enamide (PubChem CID 23534016) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is N-ethyl-N-[[4-[[ethyl(2-methylprop-2-enoyl)amino]methyl]cyclohexyl]methyl]-2-methylprop-2-enamide.
| Compound Name | N-ethyl-N-[[4-[[ethyl(2-methylprop-2-enoyl)amino]methyl]cyclohexyl]methyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23534016 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | N-ethyl-N-[[4-[[ethyl(2-methylprop-2-enoyl)amino]methyl]cyclohexyl]methyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CC)CC1CCC(CN(CC)C(=O)C(=C)C)CC1 |
| InChI | InChI=1S/C20H34N2O2/c1-7-21(19(23)15(3)4)13-17-9-11-18(12-10-17)14-22(8-2)20(24)16(5)6/h17-18H,3,5,7-14H2,1-2,4,6H3 |
| InChIKey | CIJPNOMIYNAPDW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|