C8H17NO3 — CID 174447974
acetic acid;N,N-diethylacetamide (PubChem CID 174447974) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is acetic acid;N,N-diethylacetamide.
| Compound Name | acetic acid;N,N-diethylacetamide |
|---|---|
| PubChem CID | 174447974 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | acetic acid;N,N-diethylacetamide |
| SMILES | CC(=O)O.CCN(CC)C(C)=O |
| InChI | InChI=1S/C6H13NO.C2H4O2/c1-4-7(5-2)6(3)8;1-2(3)4/h4-5H2,1-3H3;1H3,(H,3,4) |
| InChIKey | LWJDARGMZCKJKD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |