About N-ethyl-N-propylacetamide;methane;propane
N-ethyl-N-propylacetamide;methane;propane (PubChem CID 161155898) has the molecular formula C15H43NO
and a molecular weight of 253.51 g/mol. Its IUPAC name is N-ethyl-N-propylacetamide;methane;propane.
Molecular Properties
| Compound Name | N-ethyl-N-propylacetamide;methane;propane |
| PubChem CID | 161155898 |
| Molecular Formula | C15H43NO |
| Molecular Weight | 253.51 g/mol |
| Exact Mass | 253.33 |
| IUPAC Name | N-ethyl-N-propylacetamide;methane;propane |
| SMILES | C.C.C.C.C.CCC.CCCN(CC)C(C)=O |
| InChI | InChI=1S/C7H15NO.C3H8.5CH4/c1-4-6-8(5-2)7(3)9;1-3-2;;;;;/h4-6H2,1-3H3;3H2,1-2H3;5*1H4 |
| InChIKey | UPHCWPNMTNKVCH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-propylacetamide;methane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propylacetamide;methane;propane?
The IUPAC name of N-ethyl-N-propylacetamide;methane;propane (CID 161155898) is N-ethyl-N-propylacetamide;methane;propane.
What is the SMILES notation for N-ethyl-N-propylacetamide;methane;propane?
The canonical SMILES for N-ethyl-N-propylacetamide;methane;propane is C.C.C.C.C.CCC.CCCN(CC)C(C)=O.
What is the InChIKey of N-ethyl-N-propylacetamide;methane;propane?
The InChIKey is UPHCWPNMTNKVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C3H8.5CH4/c1-4-6-8(5-2)7(3)9;1-3-2;;;;;/h4-6H2,1-3H3;3H2,1-2H3;5*1H4.
What are the key properties of N-ethyl-N-propylacetamide;methane;propane?
N-ethyl-N-propylacetamide;methane;propane has a molecular weight of 253.51 g/mol, XLogP of 5.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propylacetamide;methane;propane is sourced from PubChem (CID 161155898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).