C10H19NO — CID 566252
N,N-diethyl-2,3-dimethylbut-2-enamide (PubChem CID 566252) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N,N-diethyl-2,3-dimethylbut-2-enamide.
| Compound Name | N,N-diethyl-2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 566252 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N,N-diethyl-2,3-dimethylbut-2-enamide |
| SMILES | CCN(CC)C(=O)C(C)=C(C)C |
| InChI | InChI=1S/C10H19NO/c1-6-11(7-2)10(12)9(5)8(3)4/h6-7H2,1-5H3 |
| InChIKey | GAPQEKVKZDQMFS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|