C8H16N2O — CID 173332557
3-amino-N,N-diethyl-2-methylprop-2-enamide (PubChem CID 173332557) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 3-amino-N,N-diethyl-2-methylprop-2-enamide.
| Compound Name | 3-amino-N,N-diethyl-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 173332557 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3-amino-N,N-diethyl-2-methylprop-2-enamide |
| SMILES | CCN(CC)C(=O)C(C)=CN |
| InChI | InChI=1S/C8H16N2O/c1-4-10(5-2)8(11)7(3)6-9/h6H,4-5,9H2,1-3H3 |
| InChIKey | HGUXDLUEVCIYFH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|