C12H22N2O2 — CID 21097548
(Z)-N',N',2,3-tetraethylbut-2-enediamide (PubChem CID 21097548) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (Z)-N',N',2,3-tetraethylbut-2-enediamide.
| Compound Name | (Z)-N',N',2,3-tetraethylbut-2-enediamide |
|---|---|
| PubChem CID | 21097548 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (Z)-N',N',2,3-tetraethylbut-2-enediamide |
| SMILES | CC/C(C(N)=O)=C(\CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H22N2O2/c1-5-9(11(13)15)10(6-2)12(16)14(7-3)8-4/h5-8H2,1-4H3,(H2,13,15)/b10-9- |
| InChIKey | HSHUUVSJKLBBBM-KTKRTIGZSA-N |
| XLogP | 1.46 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|