C5H14N2PbS — CID 173060169
1,1-diethylthiourea;λ2-plumbane (PubChem CID 173060169) has the molecular formula C5H14N2PbS and a molecular weight of 341.45 g/mol. Its IUPAC name is 1,1-diethylthiourea;λ2-plumbane.
| Compound Name | 1,1-diethylthiourea;λ2-plumbane |
|---|---|
| PubChem CID | 173060169 |
| Molecular Formula | C5H14N2PbS |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1,1-diethylthiourea;λ2-plumbane |
| SMILES | CCN(CC)C(N)=S.[PbH2] |
| InChI | InChI=1S/C5H12N2S.Pb.2H/c1-3-7(4-2)5(6)8;;;/h3-4H2,1-2H3,(H2,6,8);;; |
| InChIKey | CRLLIJFLMDDIOG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|