C7H18N2S2 — CID 71364945
carbamodithioic acid;N,N-diethylethanamine (PubChem CID 71364945) has the molecular formula C7H18N2S2 and a molecular weight of 194.37 g/mol. Its IUPAC name is carbamodithioic acid;N,N-diethylethanamine.
| Compound Name | carbamodithioic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 71364945 |
| Molecular Formula | C7H18N2S2 |
| Molecular Weight | 194.37 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | carbamodithioic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.NC(=S)S |
| InChI | InChI=1S/C6H15N.CH3NS2/c1-4-7(5-2)6-3;2-1(3)4/h4-6H2,1-3H3;(H3,2,3,4) |
| InChIKey | QPHMMPRFMVERHL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|