N,N-diethylethanamine;hypofluorous acid

C6H16FNO — CID 157218487

IUPACN,N-diethylethanamine;hypofluorous acid
SMILESCCN(CC)CC.OF
InChIInChI=1S/C6H15N.FHO/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;2H
InChIKeyASRVBOXMXKUULH-UHFFFAOYSA-N
MW137.20 g/mol
LogP1.21
Rot. Bonds3

About N,N-diethylethanamine;hypofluorous acid

N,N-diethylethanamine;hypofluorous acid (PubChem CID 157218487) has the molecular formula C6H16FNO and a molecular weight of 137.20 g/mol. Its IUPAC name is N,N-diethylethanamine;hypofluorous acid.

Molecular Properties

Compound NameN,N-diethylethanamine;hypofluorous acid
PubChem CID157218487
Molecular FormulaC6H16FNO
Molecular Weight137.20 g/mol
Exact Mass137.12
IUPAC NameN,N-diethylethanamine;hypofluorous acid
SMILESCCN(CC)CC.OF
InChIInChI=1S/C6H15N.FHO/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;2H
InChIKeyASRVBOXMXKUULH-UHFFFAOYSA-N
XLogP1.21
TPSA23.47 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.20
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N,N-diethylethanamine;hypofluorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylethanamine;hypofluorous acid?
The IUPAC name of N,N-diethylethanamine;hypofluorous acid (CID 157218487) is N,N-diethylethanamine;hypofluorous acid.
What is the SMILES notation for N,N-diethylethanamine;hypofluorous acid?
The canonical SMILES for N,N-diethylethanamine;hypofluorous acid is CCN(CC)CC.OF.
What is the InChIKey of N,N-diethylethanamine;hypofluorous acid?
The InChIKey is ASRVBOXMXKUULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.FHO/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;2H.
What are the key properties of N,N-diethylethanamine;hypofluorous acid?
N,N-diethylethanamine;hypofluorous acid has a molecular weight of 137.20 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;hypofluorous acid is sourced from PubChem (CID 157218487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).