About N,N-diethylethanamine;hypofluorous acid
N,N-diethylethanamine;hypofluorous acid (PubChem CID 157218487) has the molecular formula C6H16FNO
and a molecular weight of 137.20 g/mol. Its IUPAC name is N,N-diethylethanamine;hypofluorous acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;hypofluorous acid |
| PubChem CID | 157218487 |
| Molecular Formula | C6H16FNO |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N,N-diethylethanamine;hypofluorous acid |
| SMILES | CCN(CC)CC.OF |
| InChI | InChI=1S/C6H15N.FHO/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;2H |
| InChIKey | ASRVBOXMXKUULH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;hypofluorous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;hypofluorous acid?
The IUPAC name of N,N-diethylethanamine;hypofluorous acid (CID 157218487) is N,N-diethylethanamine;hypofluorous acid.
What is the SMILES notation for N,N-diethylethanamine;hypofluorous acid?
The canonical SMILES for N,N-diethylethanamine;hypofluorous acid is CCN(CC)CC.OF.
What is the InChIKey of N,N-diethylethanamine;hypofluorous acid?
The InChIKey is ASRVBOXMXKUULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.FHO/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;2H.
What are the key properties of N,N-diethylethanamine;hypofluorous acid?
N,N-diethylethanamine;hypofluorous acid has a molecular weight of 137.20 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;hypofluorous acid is sourced from PubChem (CID 157218487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).