About N,N-diethylethanamine;bis(trifluoroborane)
N,N-diethylethanamine;bis(trifluoroborane) (PubChem CID 161426908) has the molecular formula C6H15B2F6N
and a molecular weight of 236.81 g/mol. Its IUPAC name is N,N-diethylethanamine;bis(trifluoroborane).
Molecular Properties
| Compound Name | N,N-diethylethanamine;bis(trifluoroborane) |
| PubChem CID | 161426908 |
| Molecular Formula | C6H15B2F6N |
| Molecular Weight | 236.81 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N,N-diethylethanamine;bis(trifluoroborane) |
| SMILES | CCN(CC)CC.FB(F)F.FB(F)F |
| InChI | InChI=1S/C6H15N.2BF3/c1-4-7(5-2)6-3;2*2-1(3)4/h4-6H2,1-3H3;; |
| InChIKey | VXMBSVVTXYWGMF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;bis(trifluoroborane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;bis(trifluoroborane)?
The IUPAC name of N,N-diethylethanamine;bis(trifluoroborane) (CID 161426908) is N,N-diethylethanamine;bis(trifluoroborane).
What is the SMILES notation for N,N-diethylethanamine;bis(trifluoroborane)?
The canonical SMILES for N,N-diethylethanamine;bis(trifluoroborane) is CCN(CC)CC.FB(F)F.FB(F)F.
What is the InChIKey of N,N-diethylethanamine;bis(trifluoroborane)?
The InChIKey is VXMBSVVTXYWGMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2BF3/c1-4-7(5-2)6-3;2*2-1(3)4/h4-6H2,1-3H3;;.
What are the key properties of N,N-diethylethanamine;bis(trifluoroborane)?
N,N-diethylethanamine;bis(trifluoroborane) has a molecular weight of 236.81 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;bis(trifluoroborane) is sourced from PubChem (CID 161426908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).