C10H20AuN2S4 — CID 87918592
diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;gold (PubChem CID 87918592) has the molecular formula C10H20AuN2S4 and a molecular weight of 493.52 g/mol. Its IUPAC name is diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;gold.
| Compound Name | diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;gold |
|---|---|
| PubChem CID | 87918592 |
| Molecular Formula | C10H20AuN2S4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;gold |
| SMILES | CCN(CC)C(=S)SSC(=S)N(CC)CC.[Au] |
| InChI | InChI=1S/C10H20N2S4.Au/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4;/h5-8H2,1-4H3; |
| InChIKey | NZFYLMVQVLSFMF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|