C20H24N2O2S4 — CID 164611300
[ethyl-[(4-hydroxyphenyl)methyl]carbamothioyl]sulfanyl N-ethyl-N-[(4-hydroxyphenyl)methyl]carbamodithioate (PubChem CID 164611300) has the molecular formula C20H24N2O2S4 and a molecular weight of 452.69 g/mol. Its IUPAC name is [ethyl-[(4-hydroxyphenyl)methyl]carbamothioyl]sulfanyl N-ethyl-N-[(4-hydroxyphenyl)methyl]carbamodithioate.
| Compound Name | [ethyl-[(4-hydroxyphenyl)methyl]carbamothioyl]sulfanyl N-ethyl-N-[(4-hydroxyphenyl)methyl]carbamodithioate |
|---|---|
| PubChem CID | 164611300 |
| Molecular Formula | C20H24N2O2S4 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | [ethyl-[(4-hydroxyphenyl)methyl]carbamothioyl]sulfanyl N-ethyl-N-[(4-hydroxyphenyl)methyl]carbamodithioate |
| SMILES | CCN(Cc1ccc(O)cc1)C(=S)SSC(=S)N(CC)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C20H24N2O2S4/c1-3-21(13-15-5-9-17(23)10-6-15)19(25)27-28-20(26)22(4-2)14-16-7-11-18(24)12-8-16/h5-12,23-24H,3-4,13-14H2,1-2H3 |
| InChIKey | KSYKRGUKXLCIKX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|