C10H20N2OS3 — CID 122489157
S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate (PubChem CID 122489157) has the molecular formula C10H20N2OS3 and a molecular weight of 280.48 g/mol. Its IUPAC name is S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate.
| Compound Name | S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate |
|---|---|
| PubChem CID | 122489157 |
| Molecular Formula | C10H20N2OS3 |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)SSC(=S)N(CC)CC |
| InChI | InChI=1S/C10H20N2OS3/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | SKWROHZBYIVPEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|