About S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate
S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate (PubChem CID 122489157) has the molecular formula C10H20N2OS3
and a molecular weight of 280.48 g/mol. Its IUPAC name is S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate.
Molecular Properties
| Compound Name | S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate |
| PubChem CID | 122489157 |
| Molecular Formula | C10H20N2OS3 |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate |
| SMILES | CCN(CC)C(=O)SSC(=S)N(CC)CC |
| InChI | InChI=1S/C10H20N2OS3/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | SKWROHZBYIVPEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate?
The IUPAC name of S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate (CID 122489157) is S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate.
What is the SMILES notation for S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate?
The canonical SMILES for S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate is CCN(CC)C(=O)SSC(=S)N(CC)CC.
What is the InChIKey of S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate?
The InChIKey is SKWROHZBYIVPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2OS3/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3.
What are the key properties of S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate?
S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate has a molecular weight of 280.48 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(diethylcarbamothioylsulfanyl) N,N-diethylcarbamothioate is sourced from PubChem (CID 122489157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).