C10H18N2O3S3 — CID 14540257
2-acetamido-3-(diethylcarbamothioyldisulfanyl)propanoic acid (PubChem CID 14540257) has the molecular formula C10H18N2O3S3 and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-acetamido-3-(diethylcarbamothioyldisulfanyl)propanoic acid.
| Compound Name | 2-acetamido-3-(diethylcarbamothioyldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 14540257 |
| Molecular Formula | C10H18N2O3S3 |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-acetamido-3-(diethylcarbamothioyldisulfanyl)propanoic acid |
| SMILES | CCN(CC)C(=S)SSCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O3S3/c1-4-12(5-2)10(16)18-17-6-8(9(14)15)11-7(3)13/h8H,4-6H2,1-3H3,(H,11,13)(H,14,15) |
| InChIKey | DNPJGGSXWGXWRH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|