C10H20N2PbS4 — CID 16685131
bis(diethylcarbamothioylsulfanyl)lead (PubChem CID 16685131) has the molecular formula C10H20N2PbS4 and a molecular weight of 503.75 g/mol. Its IUPAC name is bis(diethylcarbamothioylsulfanyl)lead.
| Compound Name | bis(diethylcarbamothioylsulfanyl)lead |
|---|---|
| PubChem CID | 16685131 |
| Molecular Formula | C10H20N2PbS4 |
| Molecular Weight | 503.75 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | bis(diethylcarbamothioylsulfanyl)lead |
| SMILES | CCN(CC)C(=S)S[Pb]SC(=S)N(CC)CC |
| InChI | InChI=1S/2C5H11NS2.Pb/c2*1-3-6(4-2)5(7)8;/h2*3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | XTFSWQKNABTKAT-UHFFFAOYSA-L |
| XLogP | 3.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.75 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|