C10H20BiIN2S4 — CID 6329123
[diethylcarbamothioylsulfanyl(iodo)bismuthanyl] N,N-diethylcarbamodithioate (PubChem CID 6329123) has the molecular formula C10H20BiIN2S4 and a molecular weight of 632.44 g/mol. Its IUPAC name is [diethylcarbamothioylsulfanyl(iodo)bismuthanyl] N,N-diethylcarbamodithioate.
| Compound Name | [diethylcarbamothioylsulfanyl(iodo)bismuthanyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 6329123 |
| Molecular Formula | C10H20BiIN2S4 |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 631.94 |
| IUPAC Name | [diethylcarbamothioylsulfanyl(iodo)bismuthanyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[Bi](I)SC(=S)N(CC)CC |
| InChI | InChI=1S/2C5H11NS2.Bi.HI/c2*1-3-6(4-2)5(7)8;;/h2*3-4H2,1-2H3,(H,7,8);;1H/q;;+3;/p-3 |
| InChIKey | ZBHKOCQJFCBHIU-UHFFFAOYSA-K |
| XLogP | 4.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|