C10H20N2S6 — CID 54321887
(diethylcarbamothioyltrisulfanyl) N,N-diethylcarbamodithioate (PubChem CID 54321887) has the molecular formula C10H20N2S6 and a molecular weight of 360.69 g/mol. Its IUPAC name is (diethylcarbamothioyltrisulfanyl) N,N-diethylcarbamodithioate.
| Compound Name | (diethylcarbamothioyltrisulfanyl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 54321887 |
| Molecular Formula | C10H20N2S6 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | (diethylcarbamothioyltrisulfanyl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SSSSC(=S)N(CC)CC |
| InChI | InChI=1S/C10H20N2S6/c1-5-11(6-2)9(13)15-17-18-16-10(14)12(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | SSFWRALQHVKBRP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|