C22H44N6S12 — CID 174871842
diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;bis(dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate) (PubChem CID 174871842) has the molecular formula C22H44N6S12 and a molecular weight of 777.44 g/mol. Its IUPAC name is diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;bis(dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate).
| Compound Name | diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;bis(dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate) |
|---|---|
| PubChem CID | 174871842 |
| Molecular Formula | C22H44N6S12 |
| Molecular Weight | 777.44 g/mol |
| Exact Mass | 776.03 |
| IUPAC Name | diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate;bis(dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate) |
| SMILES | CCN(CC)C(=S)SSC(=S)N(CC)CC.CN(C)C(=S)SSC(=S)N(C)C.CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C10H20N2S4.2C6H12N2S4/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4;2*1-7(2)5(9)11-12-6(10)8(3)4/h5-8H2,1-4H3;2*1-4H3 |
| InChIKey | NGKSSMIZEGITBW-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.44 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|