C6H16N2S4Si — CID 174934589
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;silane (PubChem CID 174934589) has the molecular formula C6H16N2S4Si and a molecular weight of 272.56 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;silane.
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;silane |
|---|---|
| PubChem CID | 174934589 |
| Molecular Formula | C6H16N2S4Si |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;silane |
| SMILES | CN(C)C(=S)SSC(=S)N(C)C.[SiH4] |
| InChI | InChI=1S/C6H12N2S4.H4Si/c1-7(2)5(9)11-12-6(10)8(3)4;/h1-4H3;1H4 |
| InChIKey | SEVCPDOIJHJWSG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|