C10H23N3S4 — CID 174654493
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine (PubChem CID 174654493) has the molecular formula C10H23N3S4 and a molecular weight of 313.58 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine.
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine |
|---|---|
| PubChem CID | 174654493 |
| Molecular Formula | C10H23N3S4 |
| Molecular Weight | 313.58 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine |
| SMILES | CCNCC.CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C6H12N2S4.C4H11N/c1-7(2)5(9)11-12-6(10)8(3)4;1-3-5-4-2/h1-4H3;5H,3-4H2,1-2H3 |
| InChIKey | AONABPWSXYDYPB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|