About dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine (PubChem CID 174654493) has the molecular formula C10H23N3S4
and a molecular weight of 313.58 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine.
Molecular Properties
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine |
| PubChem CID | 174654493 |
| Molecular Formula | C10H23N3S4 |
| Molecular Weight | 313.58 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine |
| SMILES | CCNCC.CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C6H12N2S4.C4H11N/c1-7(2)5(9)11-12-6(10)8(3)4;1-3-5-4-2/h1-4H3;5H,3-4H2,1-2H3 |
| InChIKey | AONABPWSXYDYPB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine?
The IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine (CID 174654493) is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine.
What is the SMILES notation for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine?
The canonical SMILES for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine is CCNCC.CN(C)C(=S)SSC(=S)N(C)C.
What is the InChIKey of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine?
The InChIKey is AONABPWSXYDYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S4.C4H11N/c1-7(2)5(9)11-12-6(10)8(3)4;1-3-5-4-2/h1-4H3;5H,3-4H2,1-2H3.
What are the key properties of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine?
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine has a molecular weight of 313.58 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;N-ethylethanamine is sourced from PubChem (CID 174654493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).