About dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol (PubChem CID 174806939) has the molecular formula C8H18N2OS4
and a molecular weight of 286.51 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol.
Molecular Properties
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol |
| PubChem CID | 174806939 |
| Molecular Formula | C8H18N2OS4 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol |
| SMILES | CCO.CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C6H12N2S4.C2H6O/c1-7(2)5(9)11-12-6(10)8(3)4;1-2-3/h1-4H3;3H,2H2,1H3 |
| InChIKey | JZLGAXIEHWMZIT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol?
The IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol (CID 174806939) is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol.
What is the SMILES notation for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol?
The canonical SMILES for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol is CCO.CN(C)C(=S)SSC(=S)N(C)C.
What is the InChIKey of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol?
The InChIKey is JZLGAXIEHWMZIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S4.C2H6O/c1-7(2)5(9)11-12-6(10)8(3)4;1-2-3/h1-4H3;3H,2H2,1H3.
What are the key properties of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol?
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol has a molecular weight of 286.51 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;ethanol is sourced from PubChem (CID 174806939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).