C11H25NS2Si — CID 91733838
[tert-butyl(dimethyl)silyl] N,N-diethylcarbamodithioate (PubChem CID 91733838) has the molecular formula C11H25NS2Si and a molecular weight of 263.55 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] N,N-diethylcarbamodithioate.
| Compound Name | [tert-butyl(dimethyl)silyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 91733838 |
| Molecular Formula | C11H25NS2Si |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H25NS2Si/c1-8-12(9-2)10(13)14-15(6,7)11(3,4)5/h8-9H2,1-7H3 |
| InChIKey | YKNOGFHGMQWFDG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|