C15H29NSSi — CID 177383766
(2Z)-2-[tert-butyl(dimethyl)silyl]-N,N-diethylpenta-2,4-dienethioamide (PubChem CID 177383766) has the molecular formula C15H29NSSi and a molecular weight of 283.56 g/mol. Its IUPAC name is (2Z)-2-[tert-butyl(dimethyl)silyl]-N,N-diethylpenta-2,4-dienethioamide.
| Compound Name | (2Z)-2-[tert-butyl(dimethyl)silyl]-N,N-diethylpenta-2,4-dienethioamide |
|---|---|
| PubChem CID | 177383766 |
| Molecular Formula | C15H29NSSi |
| Molecular Weight | 283.56 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (2Z)-2-[tert-butyl(dimethyl)silyl]-N,N-diethylpenta-2,4-dienethioamide |
| SMILES | C=C/C=C(/C(=S)N(CC)CC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NSSi/c1-9-12-13(14(17)16(10-2)11-3)18(7,8)15(4,5)6/h9,12H,1,10-11H2,2-8H3/b13-12- |
| InChIKey | GSHOJSKEIXZRHN-SEYXRHQNSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|