C17H31N — CID 167148339
N-buta-1,3-dien-2-yl-N-ethyl-7,7-dimethyl-6-methylideneoctan-1-amine (PubChem CID 167148339) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N-ethyl-7,7-dimethyl-6-methylideneoctan-1-amine.
| Compound Name | N-buta-1,3-dien-2-yl-N-ethyl-7,7-dimethyl-6-methylideneoctan-1-amine |
|---|---|
| PubChem CID | 167148339 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N-ethyl-7,7-dimethyl-6-methylideneoctan-1-amine |
| SMILES | C=CC(=C)N(CC)CCCCCC(=C)C(C)(C)C |
| InChI | InChI=1S/C17H31N/c1-8-16(4)18(9-2)14-12-10-11-13-15(3)17(5,6)7/h8H,1,3-4,9-14H2,2,5-7H3 |
| InChIKey | NJMVHPPHXCGTCZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|