About N-ethyl-N-methylbuta-1,3-dien-2-amine
N-ethyl-N-methylbuta-1,3-dien-2-amine (PubChem CID 123199652) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is N-ethyl-N-methylbuta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N-methylbuta-1,3-dien-2-amine |
| PubChem CID | 123199652 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | N-ethyl-N-methylbuta-1,3-dien-2-amine |
| SMILES | C=CC(=C)N(C)CC |
| InChI | InChI=1S/C7H13N/c1-5-7(3)8(4)6-2/h5H,1,3,6H2,2,4H3 |
| InChIKey | PENSXYNNLCJLCZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylbuta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylbuta-1,3-dien-2-amine?
The IUPAC name of N-ethyl-N-methylbuta-1,3-dien-2-amine (CID 123199652) is N-ethyl-N-methylbuta-1,3-dien-2-amine.
What is the SMILES notation for N-ethyl-N-methylbuta-1,3-dien-2-amine?
The canonical SMILES for N-ethyl-N-methylbuta-1,3-dien-2-amine is C=CC(=C)N(C)CC.
What is the InChIKey of N-ethyl-N-methylbuta-1,3-dien-2-amine?
The InChIKey is PENSXYNNLCJLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-5-7(3)8(4)6-2/h5H,1,3,6H2,2,4H3.
What are the key properties of N-ethyl-N-methylbuta-1,3-dien-2-amine?
N-ethyl-N-methylbuta-1,3-dien-2-amine has a molecular weight of 111.19 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylbuta-1,3-dien-2-amine is sourced from PubChem (CID 123199652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).