C12H17N — CID 134994848
N,N-diethylcyclooctatetraenamine (PubChem CID 134994848) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is N,N-diethylcyclooctatetraenamine.
| Compound Name | N,N-diethylcyclooctatetraenamine |
|---|---|
| PubChem CID | 134994848 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N,N-diethylcyclooctatetraenamine |
| SMILES | CCN(CC)C1=C/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C12H17N/c1-3-13(4-2)12-10-8-6-5-7-9-11-12/h5-11H,3-4H2,1-2H3/b6-5-,7-5-,8-6-,9-7-,10-8-,11-9-,12-10+,12-11+ |
| InChIKey | NBKZEFCNMWGVQP-QSYCWFOISA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |