About N,N-di(propan-2-yl)aniline;bis(yttrium)
N,N-di(propan-2-yl)aniline;bis(yttrium) (PubChem CID 135024456) has the molecular formula C12H17NY2-2
and a molecular weight of 353.09 g/mol. Its IUPAC name is N,N-di(propan-2-yl)aniline;bis(yttrium).
Molecular Properties
| Compound Name | N,N-di(propan-2-yl)aniline;bis(yttrium) |
| PubChem CID | 135024456 |
| Molecular Formula | C12H17NY2-2 |
| Molecular Weight | 353.09 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | N,N-di(propan-2-yl)aniline;bis(yttrium) |
| SMILES | CC(C)N(c1[c-]ccc[c-]1)C(C)C.[Y].[Y] |
| InChI | InChI=1S/C12H17N.2Y/c1-10(2)13(11(3)4)12-8-6-5-7-9-12;;/h5-7,10-11H,1-4H3;;/q-2;; |
| InChIKey | UFGGMQIVAPFLFZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-di(propan-2-yl)aniline;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(propan-2-yl)aniline;bis(yttrium)?
The IUPAC name of N,N-di(propan-2-yl)aniline;bis(yttrium) (CID 135024456) is N,N-di(propan-2-yl)aniline;bis(yttrium).
What is the SMILES notation for N,N-di(propan-2-yl)aniline;bis(yttrium)?
The canonical SMILES for N,N-di(propan-2-yl)aniline;bis(yttrium) is CC(C)N(c1[c-]ccc[c-]1)C(C)C.[Y].[Y].
What is the InChIKey of N,N-di(propan-2-yl)aniline;bis(yttrium)?
The InChIKey is UFGGMQIVAPFLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.2Y/c1-10(2)13(11(3)4)12-8-6-5-7-9-12;;/h5-7,10-11H,1-4H3;;/q-2;;.
What are the key properties of N,N-di(propan-2-yl)aniline;bis(yttrium)?
N,N-di(propan-2-yl)aniline;bis(yttrium) has a molecular weight of 353.09 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(propan-2-yl)aniline;bis(yttrium) is sourced from PubChem (CID 135024456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).